AE15007
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | 1 week | $353.00 | $247.00 | - + | |
5mg | 98% | 1 week | $899.00 | $629.00 | - + | |
10mg | 98% | 1 week | $1,408.00 | $985.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15007 |
Chemical Name: | ANECORTAVE ACETATE RELATED COMPOUND A (20 MG) (9(11 )-DEHYDROCORTISOL) |
CAS Number: | 10184-70-0 |
Molecular Formula: | C21H28O4 |
Molecular Weight: | 344.4446 |
MDL Number: | MFCD00271920 |
SMILES: | OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)CC=C1[C@H]2CCC2=CC(=O)CC[C@]12C |
21-Desacetyl Anecortave is a crucial compound utilized in chemical synthesis due to its unique properties and versatile applications. In the realm of organic chemistry, this compound serves as a key intermediate in the synthesis of various pharmaceuticals and bioactive molecules. Its structural functionality enables the introduction of specific functional groups, allowing chemists to manipulate its chemical reactivity for targeted transformations.In particular, 21-Desacetyl Anecortave plays a significant role in the development of novel drug candidates and therapeutic agents. Its strategic placement within synthetic pathways facilitates the construction of complex molecular frameworks with high precision and efficiency. This compound serves as a building block for creating diverse chemical structures that exhibit desired biological activities, making it a valuable tool in drug discovery and development.Furthermore, in the field of medicinal chemistry, 21-Desacetyl Anecortave has been instrumental in the synthesis of analogs and derivatives with improved pharmacokinetic profiles and enhanced therapeutic potential. Its involvement in the formation of pharmacophores and lead optimization underscores its importance in the pursuit of innovative drug design strategies.Overall, the application of 21-Desacetyl Anecortave in chemical synthesis exemplifies its utility as a strategic intermediate for constructing molecular frameworks with pharmaceutical relevance and therapeutic implications. Its versatility and role in medicinal chemistry highlight its significance in advancing the frontiers of drug discovery and synthetic organic chemistry.