AA07292
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $27.00 | $19.00 | - + | |
250mg | 97% | in stock | $65.00 | $46.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07292 |
Chemical Name: | 4-Chloro-2-(trifluoromethyl)nicotinic acid |
CAS Number: | 1018678-39-1 |
Molecular Formula: | C7H3ClF3NO2 |
Molecular Weight: | 225.5524 |
MDL Number: | MFCD22546902 |
SMILES: | OC(=O)c1c(Cl)ccnc1C(F)(F)F |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
4-Chloro-2-(trifluoromethyl)nicotinic acid is a highly versatile compound widely used in chemical synthesis. Its unique chemical structure makes it a valuable building block in various organic reactions, offering a range of applications in the field of synthetic chemistry. One of the primary uses of 4-Chloro-2-(trifluoromethyl)nicotinic acid is as a key intermediate in the synthesis of pharmaceutical compounds. Its functional groups provide opportunities for derivatization, allowing for the introduction of specific chemical moieties that are crucial for the development of new drugs. Additionally, its trifluoromethyl group is known to enhance the biological activity of drug molecules, making it a sought-after component in drug design.Furthermore, this compound is often employed in the preparation of agrochemicals and specialty chemicals. Its structural features enable the creation of complex molecules with tailored properties, such as herbicides, insecticides, and fungicides. The presence of the chloro and trifluoromethyl groups imparts desirable characteristics to these chemical agents, enhancing their effectiveness and selectivity.In summary, 4-Chloro-2-(trifluoromethyl)nicotinic acid serves as a valuable tool in chemical synthesis, offering diverse opportunities for the creation of biologically active compounds, agrochemicals, and specialty chemicals. Its versatility and unique reactivity make it a key ingredient in the development of innovative products across various industries.