logo
Home  > sodium hydrogen 2,2'-methylenebis[4-chlorophenolate]

AE54949

10187-52-7 | sodium hydrogen 2,2'-methylenebis[4-chlorophenolate]

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE54949
Chemical Name: sodium hydrogen 2,2'-methylenebis[4-chlorophenolate]
CAS Number: 10187-52-7
Molecular Formula: C13H9Cl2NaO2
Molecular Weight: 291.1051
MDL Number: MFCD00036133
SMILES: Clc1ccc(c(c1)Cc1cc(Cl)ccc1O)[O-].[Na+]

 

Upstream Synthesis Route 
  • Phenol, 2,2′-methylenebis[4-chloro-, sodium salt (1:1) plays a crucial role in chemical synthesis as a versatile reagent. Its unique structure and properties make it an essential building block in the development of various compounds. This compound is commonly utilized as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity and stability make it a valuable tool in the creation of complex organic molecules used in a wide range of industries. Additionally, its water solubility and compatibility with a variety of solvents allow for ease of handling and incorporation in diverse synthetic pathways.
FEATURED PRODUCTS