AA07425
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 96% | in stock | $67.00 | $47.00 | - + | |
50mg | 96% | in stock | $102.00 | $72.00 | - + | |
100mg | 96% | in stock | $180.00 | $126.00 | - + | |
250mg | 96% | in stock | $355.00 | $249.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07425 |
Chemical Name: | PHENANTHRO[3,4-D]-1,3-DIOXOLE-5-CARBOXYLIC ACID, 8-METHOXY-6-NITRO-, SODIUM SALT (1:1) |
CAS Number: | 10190-99-5 |
Molecular Formula: | C17H10NNaO7 |
Molecular Weight: | 363.2536 |
MDL Number: | MFCD00210760 |
SMILES: | COc1cccc2c1cc([N+](=O)[O-])c1c2c2OCOc2cc1C(=O)[O-].[Na+] |
Phenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid, 8-methoxy-6-nitro-, sodium salt (1:1) is a versatile compound commonly used in chemical synthesis due to its unique reactivity and structural properties. In organic chemistry, this compound serves as a key building block for the synthesis of various heterocyclic compounds and pharmaceutical intermediates. Its ability to undergo various chemical reactions makes it a valuable tool in designing and creating new molecules with desired properties. Additionally, its sodium salt form enhances its solubility and stability, making it easier to handle and manipulate in laboratory settings. Overall, this compound plays a crucial role in expanding the chemical toolbox available to synthetic chemists for the development of novel compounds and materials.