AA07843
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $106.00 | $75.00 | - + | |
1g | 95% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07843 |
Chemical Name: | 2-(7-Hydroxy-2-oxo-2H-chromen-4-yl)acetamide |
CAS Number: | 101999-45-5 |
Molecular Formula: | C11H9NO4 |
Molecular Weight: | 219.1935 |
MDL Number: | MFCD06001840 |
SMILES: | NC(=O)Cc1cc(=O)oc2c1ccc(c2)O |
The compound 2-(7-Hydroxy-2-oxo-2H-chromen-4-yl)acetamide plays a crucial role in chemical synthesis, particularly in the field of medicinal chemistry and drug development. Its unique structure containing a chromenyl moiety combined with an acetamide functional group makes it a versatile building block for creating novel pharmaceutical compounds.This compound can be utilized as a key intermediate in the synthesis of bioactive molecules due to its potential to undergo various chemical transformations. The presence of the chromenyl group offers opportunities for further modification through functional group interconversions, allowing the incorporation of diverse chemical functionalities. Additionally, the acetamide functionality can serve as a directing group for regioselective reactions, enabling precise control over the site of reactivity.In drug discovery processes, 2-(7-Hydroxy-2-oxo-2H-chromen-4-yl)acetamide can be used to introduce specific pharmacophores or structural motifs into lead compounds, thereby fine-tuning their biological activities and pharmacological properties. This compound's synthetic versatility and potential for structural diversification make it a valuable tool for designing and synthesizing new drug candidates with enhanced efficacy and improved pharmacokinetic profiles.