AA08004
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $28.00 | $19.00 | - + | |
10mg | 98% | in stock | $107.00 | $75.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08004 |
Chemical Name: | SGI-1027 |
CAS Number: | 1020149-73-8 |
Molecular Formula: | C27H23N7O |
Molecular Weight: | 461.5178 |
MDL Number: | MFCD27937047 |
SMILES: | Cc1cc(Nc2ccc(cc2)NC(=O)c2ccc(cc2)Nc2ccnc3c2cccc3)nc(n1)N |
Complexity: | 676 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.8 |
The Journal of biological chemistry 20150306
Journal of medicinal chemistry 20140213
The Journal of biological chemistry 20130816