logo
Home  > Benzenamine, 3-methyl-2,4-dinitro-

AI05549

10202-92-3 | Benzenamine, 3-methyl-2,4-dinitro-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI05549
Chemical Name: Benzenamine, 3-methyl-2,4-dinitro-
CAS Number: 10202-92-3
Molecular Formula: C7H7N3O4
Molecular Weight: 197.1482
MDL Number: MFCD01679549
SMILES: [O-][N+](=O)c1ccc(c(c1C)[N+](=O)[O-])N

 

Upstream Synthesis Route 
  • 3-Methyl-2,4-dinitroaniline, also known as Methyl orange, is a versatile compound widely utilized in chemical synthesis. It primarily functions as a pH indicator, changing color depending on the acidity or basicity of the solution it is present in. This characteristic makes it extremely valuable in various analytical chemistry applications, such as titrations and colorimetric assays.Furthermore, 3-Methyl-2,4-dinitroaniline's chemical properties also lend themselves well to organic synthesis processes. It is commonly employed as a reagent in the preparation of various dyes, pharmaceuticals, and agricultural chemicals. Due to its unique structure and properties, this compound serves as a crucial building block in the creation of more complex organic molecules, contributing significantly to the advancement of chemical research and development.
FEATURED PRODUCTS