AE10223
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $475.00 | $332.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10223 |
Chemical Name: | 21-Hydroxyoligomycin A |
CAS Number: | 102042-09-1 |
Molecular Formula: | C45H74O12 |
Molecular Weight: | 807.0619 |
MDL Number: | MFCD09752734 |
SMILES: | CC[C@H]1/C=C/C=C/C[C@@H](C)[C@H](O)[C@@](C)(O)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)[C@H]([C@@H]([C@H](/C=C/C(=O)O[C@@H]2[C@@H]([C@H](C[C@H]1O)O[C@]1(CC[C@@H]([C@@H](O1)C[C@H](O)C)C)[C@H]2C)C)C)O)C |
21-Hydroxyoligomycin A is a valuable compound in chemical synthesis due to its unique structure and versatile reactivity. As a member of the oligomycin family, this compound showcases a hydroxyl group at the C-21 position, offering a key functional handle for various synthetic transformations.One of the primary applications of 21-Hydroxyoligomycin A in chemical synthesis is as a building block for the construction of complex molecules. The hydroxyl group at C-21 can serve as a site for functional group modification, enabling the attachment of different molecular fragments through various synthetic reactions such as esterification, etherification, or oxidation.Additionally, 21-Hydroxyoligomycin A can be utilized as a precursor for the synthesis of analogs with enhanced biological activities or improved physicochemical properties. By selectively modifying the hydroxyl group or other regions of the molecule, chemists can generate novel derivatives with tailored properties for specific applications in drug discovery, material science, or bioconjugation.Furthermore, the structural features of 21-Hydroxyoligomycin A make it a valuable intermediate in total synthesis strategies aimed at accessing natural products or biologically active compounds. Its complex polycyclic framework and functional groups offer synthetic chemists a challenging yet rewarding target for developing innovative synthetic methodologies and strategic transformations.In conclusion, the versatility of 21-Hydroxyoligomycin A as a building block, precursor, and key intermediate highlights its significance in advancing chemical synthesis and expanding the toolbox available to synthetic chemists for the creation of diverse and intricate molecular structures.