logo
Home  > [4-(5-Chloro-3-methyl-1h-pyrazol-1-yl)phenyl]amine dihydrochloride

AE13872

1020707-02-1 | [4-(5-Chloro-3-methyl-1h-pyrazol-1-yl)phenyl]amine dihydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $169.00 $118.00 -   +
5g 95% in stock $634.00 $444.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE13872
Chemical Name: [4-(5-Chloro-3-methyl-1h-pyrazol-1-yl)phenyl]amine dihydrochloride
CAS Number: 1020707-02-1
Molecular Formula: C10H11Cl2N3
Molecular Weight: 244.1204
MDL Number: MFCD15147422
SMILES: Nc1ccc(cc1)n1nc(cc1Cl)C.Cl

 

Upstream Synthesis Route 
  • The compound [4-(5-Chloro-3-methyl-1H-pyrazol-1-yl)phenyl]amine dihydrochloride is a versatile reagent commonly used in chemical synthesis. Its unique structure allows for precise control over reactions, making it particularly useful in medicinal chemistry and pharmaceutical research. This compound is often employed as a key building block in the synthesis of various biologically active molecules, enabling the creation of novel drug candidates and research tools. Additionally, its selective reactivity and compatibility with a wide range of functional groups make it a valuable tool for the formation of complex molecular architectures.
FEATURED PRODUCTS