AA08304
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | in stock | $1,245.00 | $872.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08304 |
Chemical Name: | Benzene-2,3,5,6-d4-sulfonamide, 4-amino-N-2-pyrimidinyl- |
CAS Number: | 1020719-78-1 |
Molecular Formula: | C10H6D4N4O2S |
Molecular Weight: | 254.3016 |
MDL Number: | MFCD03701228 |
SMILES: | [2H]c1c([2H])c(N)c(c(c1S(=O)(=O)Nc1ncccn1)[2H])[2H] |
Sulfadiazine-d4 is utilized as a stable isotope-labeled analog of the antibiotic Sulfadiazine. Its application in chemical synthesis primarily revolves around its use as a valuable internal standard for quantitative analysis in various research and laboratory settings. Specifically, the deuterium-labeled variant of Sulfadiazine enables accurate determination of the compound's concentration in complex mixtures through techniques like mass spectrometry. Additionally, Sulfadiazine-d4 serves as a key tool in elucidating reaction mechanisms, studying metabolic pathways, and conducting pharmacokinetic studies. Its incorporation in chemical synthesis processes aids in enhancing precision and reliability of analytical results, making it an indispensable component in the realm of scientific investigation and discovery.