logo
Home  > 3-Fluoro-n-[5-(methylsulfanyl)-4h-1,2,4-triazol-3-yl]benzamide

AJ28125

1021266-89-6 | 3-Fluoro-n-[5-(methylsulfanyl)-4h-1,2,4-triazol-3-yl]benzamide

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% 2 weeks $1,272.00 $891.00 -   +
2g 95% 2 weeks $1,605.00 $1,124.00 -   +
5g 95% 2 weeks $2,120.00 $1,484.00 -   +
10g 95% 2 weeks $2,923.00 $2,046.00 -   +
25g 95% 2 weeks $4,014.00 $2,810.00 -   +
50g 95% 2 weeks $5,555.00 $3,889.00 -   +
100g 95% 2 weeks $7,762.00 $5,434.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AJ28125
Chemical Name: 3-Fluoro-n-[5-(methylsulfanyl)-4h-1,2,4-triazol-3-yl]benzamide
CAS Number: 1021266-89-6
Molecular Formula: C10H9FN4OS
Molecular Weight: 252.2681
MDL Number: MFCD11226342
SMILES: CSc1nnc([nH]1)NC(=O)c1cccc(c1)F

 

Upstream Synthesis Route 
  • 3-Fluoro-N-(5-methylsulfanyl-4H-[1,2,4]triazol-3-yl)-benzamide serves as a versatile building block in chemical synthesis due to its unique structural properties. This compound is commonly employed as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and biologically active molecules. Its strategic placement of functional groups allows for the introduction of additional substituents, enabling the creation of diverse molecular architectures with specific properties and activities. In organic synthesis, this compound plays a crucial role in forming complex molecules through reactions such as acylation, amidation, and Suzuki coupling, leading to the development of novel compounds for various applications in chemistry and life sciences.
FEATURED PRODUCTS