AE25176
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $29.00 | $20.00 | - + | |
1g | 95% | in stock | $49.00 | $34.00 | - + | |
5g | 95% | in stock | $108.00 | $75.00 | - + | |
10g | 95% | in stock | $213.00 | $149.00 | - + | |
25g | 95% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25176 |
Chemical Name: | 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one |
CAS Number: | 1021306-45-5 |
Molecular Formula: | C19H19BO3 |
Molecular Weight: | 306.16336 |
MDL Number: | MFCD16294551 |
SMILES: | O=C1c2cc(ccc2-c2c1cccc2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 485 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one is a versatile compound widely utilized in chemical synthesis as a key building block. Its boron-containing structure imparts unique reactivity, making it valuable for various synthetic applications. In organic synthesis, this compound serves as a crucial reagent for Suzuki-Miyaura cross-coupling reactions, enabling the efficient formation of carbon-carbon bonds. Additionally, it is a valuable intermediate in the synthesis of organic materials, pharmaceuticals, and agrochemicals. The ability of 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-one to undergo diverse transformations underscores its importance in modern chemical synthesis strategies.