AE17021
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $44.00 | $31.00 | - + | |
250mg | 95% | in stock | $80.00 | $56.00 | - + | |
1g | 95% | in stock | $275.00 | $193.00 | - + | |
5g | 95% | in stock | $1,347.00 | $943.00 | - + | |
10g | 95% | in stock | $2,370.00 | $1,659.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE17021 |
Chemical Name: | 3-Bromo-1-nitronaphthalene |
CAS Number: | 102153-47-9 |
Molecular Formula: | C10H6BrNO2 |
Molecular Weight: | 252.0641 |
MDL Number: | MFCD01464123 |
SMILES: | Brc1cc2ccccc2c(c1)[N+](=O)[O-] |
Complexity: | 229 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 3.7 |
3-Bromo-1-nitronaphthalene is a versatile compound widely used in chemical synthesis as a key building block. Known for its valuable reactivity and unique structural attributes, this compound plays a crucial role in the creation of various organic compounds. Its primary application lies in the field of organic chemistry, where it serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.In chemical synthesis, 3-Bromo-1-nitronaphthalene is frequently utilized as a precursor for the preparation of complex molecules due to its ability to participate in various reactions such as nucleophilic substitution, reduction, and cross-coupling reactions. This compound's distinctive structure, featuring both a bromine and nitro group, offers a versatile platform for functional group transformations, making it highly desirable for developing diverse chemical structures.One of the key applications of 3-Bromo-1-nitronaphthalene is its involvement in the synthesis of biologically active molecules, where it can be selectively modified to introduce specific functional groups or stereochemistry required for the target compound's activity. Additionally, this compound is commonly employed in the synthesis of dyes, pigments, and other specialty chemicals that demand precise control over molecular structure and properties.Furthermore, the reactivity and stability of 3-Bromo-1-nitronaphthalene make it a valuable tool in organic synthesis laboratories for designing and accessing new molecular architectures. Its strategic placement of functional groups allows chemists to fine-tune reaction conditions and tailor the compound for diverse synthetic pathways, enabling the rapid and efficient construction of complex molecules.In conclusion, 3-Bromo-1-nitronaphthalene serves as a pivotal component in chemical synthesis, providing chemists with a versatile and reliable building block for the creation of diverse organic compounds with applications spanning pharmaceuticals, agrochemicals, and materials science. Its reactivity, stability, and structural characteristics make it a valuable asset in the toolkit of synthetic chemists seeking to advance the frontiers of organic chemistry.