logo
Home  > 4-Methyl-2-(trifluoromethyl)phenylboronic acid

AA08645

1021860-94-5 | 4-Methyl-2-(trifluoromethyl)phenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $56.00 $39.00 -   +
250mg 95% in stock $75.00 $52.00 -   +
500mg 95% in stock $129.00 $91.00 -   +
1g 95% in stock $178.00 $124.00 -   +
5g 95% in stock $636.00 $445.00 -   +
10g 95% in stock $1,178.00 $824.00 -   +
25g 95% in stock $2,530.00 $1,771.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA08645
Chemical Name: 4-Methyl-2-(trifluoromethyl)phenylboronic acid
CAS Number: 1021860-94-5
Molecular Formula: C8H8BF3O2
Molecular Weight: 203.9541
MDL Number: MFCD11616521
SMILES: Cc1ccc(c(c1)C(F)(F)F)B(O)O

 

Upstream Synthesis Route 
  • The (4-Methyl-2-(trifluoromethyl)phenyl)boronic acid is a valuable reagent in organic chemistry due to its ability to participate in various chemical transformations. This compound serves as a key building block in the synthesis of biologically active molecules, pharmaceuticals, agrochemicals, and materials. Its boronic acid functionality enables it to act as a versatile coupling partner in Suzuki-Miyaura cross-coupling reactions, forming carbon-carbon bonds efficiently under mild conditions. Additionally, the trifluoromethyl group provides enhanced lipophilicity and can modulate the physicochemical properties of the target molecules. Overall, the (4-Methyl-2-(trifluoromethyl)phenyl)boronic acid plays a crucial role in modern organic synthesis strategies, facilitating the creation of diverse and complex chemical structures with high efficiency and selectivity.
FEATURED PRODUCTS