AA08642
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 97% | in stock | $18.00 | $12.00 | - + | |
10mg | 97% | in stock | $22.00 | $15.00 | - + | |
50mg | 97% | in stock | $26.00 | $18.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08642 |
Chemical Name: | ZM39923 Hydrochloride |
CAS Number: | 1021868-92-7 |
Molecular Formula: | C23H26ClNO |
Molecular Weight: | 367.9116 |
MDL Number: | MFCD04974534 |
SMILES: | CC(N(Cc1ccccc1)CCC(=O)c1ccc2c(c1)cccc2)C.Cl |
The compound $name$ is a versatile chemical reagent commonly used in chemical synthesis due to its unique structure and properties. It serves as a valuable building block in organic chemistry reactions, particularly in the synthesis of pharmaceuticals, fine chemicals, and complex organic molecules.1. Designed for Selective Functionalization: $name$ is carefully crafted with a 3-(Benzyl(isopropyl)amino)-1-(naphthalen-2-yl)propan-1-one framework that enables selective functionalization at key positions. This feature allows chemists to introduce specific substituents or functional groups with precision, facilitating the synthesis of target compounds with desired properties.2. Facilitates Multi-step Synthesis: Due to its complex yet well-defined structure, $name$ can be seamlessly incorporated into multi-step synthesis routes. Its strategic placement within a synthetic sequence can streamline the overall process and enhance the efficiency of intermediate transformations, ultimately leading to improved synthetic yields and purity of the final product.3. Enables Diverse Chemical Transformations: The presence of a naphthalene moiety in $name$ offers a platform for diverse chemical transformations, including aromatic substitutions, cross-coupling reactions, and functional group interconversions. This versatility broadens the scope of synthetic pathways that can be accessed, allowing for the introduction of structural diversity and complexity in the molecular design.In summary, $name$ plays a pivotal role in chemical synthesis by serving as a versatile and reliable reagent that aids in the construction of complex organic molecules. Its unique composition and functional capabilities make it an indispensable tool for synthetic chemists seeking to efficiently access novel compounds and advance the frontiers of chemical research.