10219-69-9 | 9,11-Octadecadienoic acid, 13-hydroxy-, (9Z,11E,13R)-

Availability
Typically In Stock

Description

• Catalog Number: AA08685
• Chemical Name: 9,11-Octadecadienoic acid, 13-hydroxy-, (9Z,11E,13R)-
• CAS Number: 10219-69-9
• Molecular Formula: C18H32O3
• Molecular Weight: 296.4449
• MDL Number: MFCD00084834
• SMILES: CCCCC[C@H](/C=C/C=CCCCCCCCC(=O)O)O

Upstream Synthesis Route

Coriolic acid, also known as cis-9,12-octadecadienoic acid, is a significant compound widely employed in chemical synthesis. This compound plays a crucial role in various chemical reactions and processes due to its unique chemical properties and versatile applications.In chemical synthesis, coriolic acid is commonly utilized as a starting material to synthesize different types of fatty acids and derivatives. Its double bonds provide sites for further functionalization, allowing chemists to introduce various functional groups and modify the compound for specific applications.One key application of coriolic acid in chemical synthesis is in the production of biodiesel. By undergoing transesterification, coriolic acid can be converted into fatty acid methyl esters, which serve as environmentally friendly alternatives to traditional diesel fuels.Additionally, coriolic acid is used in the synthesis of surfactants and emulsifiers. Its amphiphilic nature enables it to interact with both polar and nonpolar compounds, making it a valuable ingredient in formulating products such as soaps, detergents, and cosmetics.Furthermore, coriolic acid can be employed in the pharmaceutical industry for the production of lipid-based drug delivery systems. Its ability to form stable micelles and lipid nanostructures makes it a suitable candidate for encapsulating and delivering poorly water-soluble drugs.Overall, coriolic acid's presence in chemical synthesis facilitates the creation of a wide range of compounds and materials that find applications in various industries, highlighting its importance as a versatile building block in organic chemistry.