10219-75-7 | EREMOPHILENE

Availability
Typically In Stock

Description

• Catalog Number: AE50290
• Chemical Name: EREMOPHILENE
• CAS Number: 10219-75-7
• Molecular Formula: C15H24
• Molecular Weight: 204.3511
• SMILES: CC(=C)[C@@H]1CCC2=CCC[C@@H]([C@]2(C1)C)C

Upstream Synthesis Route

Eremophilene is a naturally occurring sesquiterpene that is commonly found in various plant species, including certain species of fungi. In chemical synthesis, eremophilene serves as a valuable building block for the creation of complex organic compounds. Its unique structure and reactivity make it an attractive starting material for the synthesis of diverse molecules with potential applications in pharmaceuticals, fragrances, and other industries.One of the key applications of eremophilene in chemical synthesis is its role as a precursor in the synthesis of bioactive compounds. By functionalizing the double bonds or modifying the functional groups present in eremophilene, chemists can create derivatives with enhanced biological activity. These derivatives can be further studied for their potential therapeutic effects or used as lead compounds for drug development.Additionally, eremophilene can be used as a chiral building block in asymmetric synthesis. Its complex structure contains multiple stereocenters, allowing for the creation of enantiomerically pure products. This is particularly valuable in drug development, where the stereochemistry of a molecule can significantly impact its biological activity and pharmacokinetic properties.Overall, the versatile nature of eremophilene in chemical synthesis makes it a valuable tool for organic chemists seeking to access structurally diverse compounds with potential applications in various fields.