1022-31-7 | Benzenebutanoic acid, α-amino-2-(formylamino)-γ-oxo-

Packsize	Purity	Availability	Price	Discounted Price
5mg	97%	in stock	$561.00	$393.00
10mg	97%	in stock	$1,006.00	$705.00

Description

• Catalog Number: AA08734
• Chemical Name: Benzenebutanoic acid, α-amino-2-(formylamino)-γ-oxo-
• CAS Number: 1022-31-7
• Molecular Formula: C11H12N2O4
• Molecular Weight: 236.224
• MDL Number: MFCD16294964
• SMILES: O=CNc1ccccc1C(=O)CC(C(=O)O)N

Upstream Synthesis Route

Name: N-FormylkynurenineApplication in Chemical Synthesis:N-Formylkynurenine is a valuable compound in chemical synthesis due to its versatile reactivity and functionality. It serves as a key intermediate in the synthesis of various complex organic molecules and pharmaceutical compounds. Its unique structure containing both a formyl group and a kynurenine scaffold makes it a crucial building block for the creation of diverse chemical entities.In organic synthesis, N-Formylkynurenine can undergo various transformations such as condensation reactions, nucleophilic additions, and rearrangements to generate structurally intricate compounds. By utilizing the formyl group and the kynurenine backbone, chemists can manipulate its structure to introduce different functional groups and stereochemistry, allowing for precise control over the synthesis of target molecules.Furthermore, N-Formylkynurenine plays a significant role in the synthesis of bioactive compounds and pharmaceutical drugs. Its incorporation into drug molecules can impart specific biological activities, making it a valuable tool for drug discovery and development. Chemists can utilize N-Formylkynurenine to design novel pharmaceuticals with improved efficacy, safety, and specificity for targeted therapeutic applications.Overall, N-Formylkynurenine is a versatile and essential component in chemical synthesis, enabling the creation of complex organic compounds and pharmaceutical agents with precision and efficiency.