AA08942
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $25.00 | $17.00 | - + | |
5g | 97% | in stock | $39.00 | $27.00 | - + | |
25g | 97% | in stock | $124.00 | $87.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08942 |
Chemical Name: | 5-Ethylpyridine-2,3-dicarboxylic acid |
CAS Number: | 102268-15-5 |
Molecular Formula: | C9H9NO4 |
Molecular Weight: | 195.1721 |
MDL Number: | MFCD00071733 |
SMILES: | CCc1cnc(c(c1)C(=O)O)C(=O)O |
Complexity: | 241 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1 |
5-Ethylpyridine-2,3-dicarboxylic acid, also known as $name$, is a versatile chemical compound widely used in chemical synthesis processes. This compound serves as a crucial building block in the development of various organic compounds due to its unique structural properties. In chemical synthesis, $name$ is often utilized as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals.One prominent application of 5-Ethylpyridine-2,3-dicarboxylic acid is in the synthesis of novel drug candidates. Its chemical structure allows for the introduction of specific functional groups that are essential for enhancing the biological activity and pharmacokinetic properties of the final drug product. By incorporating $name$ into the synthesis pathway, chemists can streamline the production of potential medications with improved efficacy and reduced side effects.Furthermore, 5-Ethylpyridine-2,3-dicarboxylic acid plays a significant role in the development of innovative agrochemicals. Its functional groups can be modified to create new pesticide formulations that target specific pest species while minimizing environmental impacts. The versatility of $name$ enables researchers to design highly effective crop protection products that contribute to sustainable agriculture practices.Additionally, in the realm of specialty chemicals, 5-Ethylpyridine-2,3-dicarboxylic acid is valued for its ability to serve as a precursor in the synthesis of advanced materials. By leveraging the unique reactivity of this compound, scientists can fabricate intricate molecular architectures with tailored properties for diverse industrial applications. The incorporation of $name$ in chemical synthesis pathways allows for the production of high-performance materials that meet the evolving demands of modern industries.Overall, the application of 5-Ethylpyridine-2,3-dicarboxylic acid in chemical synthesis underscores its importance as a foundational compound in the creation of valuable molecules for pharmaceuticals, agrochemicals, and specialty chemicals. This versatile building block continues to empower researchers and chemists in their quest to innovate and advance various fields through the synthesis of complex organic compounds.
Dalton transactions (Cambridge, England : 2003) 20120528