logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > (2R)-2-Amino-3-(4-aminophenyl)propanoic acid hydrate

AA08989

102281-45-8 | (2R)-2-Amino-3-(4-aminophenyl)propanoic acid hydrate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $11.00 $8.00 -   +
1g 97% in stock $18.00 $13.00 -   +
5g 97% in stock $47.00 $33.00 -   +
10g 97% in stock $83.00 $58.00 -   +
25g 97% in stock $203.00 $142.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA08989
Chemical Name: (2R)-2-Amino-3-(4-aminophenyl)propanoic acid hydrate
CAS Number: 102281-45-8
Molecular Formula: C9H12N2O2
Molecular Weight: 180.20377999999997
MDL Number: MFCD08276892
SMILES: N[C@@H](C(=O)O)Cc1ccc(cc1)N

 

Computed Properties
Complexity: 177  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 3  
XLogP3: -2.2  

 

 

Upstream Synthesis Route
  • The (R)-2-Amino-3-(4-aminophenyl)propanoic acid, also known as $name$, serves as a valuable intermediate in chemical synthesis, particularly in the pharmaceutical industry. Its chiral nature and unique molecular structure make it a versatile building block for the synthesis of various biologically active compounds. When utilized in chemical reactions, (R)-2-Amino-3-(4-aminophenyl)propanoic acid can act as a key component for the creation of complex molecules with specific stereochemical properties. This compound plays a crucial role in the development of new drug candidates, as it enables chemists to access diverse chemical space and explore different molecular arrangements. Additionally, (R)-2-Amino-3-(4-aminophenyl)propanoic acid's compatibility with various reaction conditions further enhances its utility in organic synthesis, making it an essential tool for researchers working in the field of medicinal chemistry.
FEATURED PRODUCTS