logo
Home  > 8-(Trifluoromethyl)quinoline-2-carboxylic acid

AA09266

1023815-99-7 | 8-(Trifluoromethyl)quinoline-2-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $58.00 $41.00 -   +
250mg 97% in stock $102.00 $72.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA09266
Chemical Name: 8-(Trifluoromethyl)quinoline-2-carboxylic acid
CAS Number: 1023815-99-7
Molecular Formula: C11H6F3NO2
Molecular Weight: 241.1660496
MDL Number: MFCD09881320
SMILES: OC(=O)c1ccc2c(n1)c(ccc2)C(F)(F)F

 

Upstream Synthesis Route
  • 8-(Trifluoromethyl)quinoline-2-carboxylic acid is a versatile compound widely used in chemical synthesis as a key building block for various pharmaceuticals and organic compounds. Its unique structure containing a trifluoromethyl group and a quinoline ring offers valuable reactivity and functionality in synthetic chemistry. One of the significant applications of 8-(Trifluoromethyl)quinoline-2-carboxylic acid is in the synthesis of bioactive molecules and pharmaceutical intermediates. The trifluoromethyl group can enhance the biological activity and metabolic stability of the resulting compounds, making them promising candidates for drug discovery and development. Additionally, the quinoline moiety provides a versatile platform for further derivatization, allowing for the creation of diverse chemical libraries for screening purposes. Furthermore, this compound can also serve as a valuable building block in the preparation of agrochemicals, dyes, and advanced materials due to its unique structural features and reactivity. Its utilization in the synthesis of complex molecules highlights its importance in the field of organic chemistry and its role in advancing various scientific research efforts.
FEATURED PRODUCTS