AA09408
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $24.00 | $17.00 | - + | |
250mg | 95% | in stock | $28.00 | $20.00 | - + | |
1g | 95% | in stock | $91.00 | $64.00 | - + | |
5g | 95% | in stock | $365.00 | $256.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09408 |
Chemical Name: | 6-Nitro-1h-indole-2-carboxylic acid |
CAS Number: | 10242-00-9 |
Molecular Formula: | C9H6N2O4 |
Molecular Weight: | 206.1549 |
MDL Number: | MFCD02664466 |
SMILES: | [O-][N+](=O)c1ccc2c(c1)[nH]c(c2)C(=O)O |
Complexity: | 288 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.1 |
6-Nitro-1H-indole-2-carboxylic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals due to its unique chemical properties.As a valuable intermediate in organic synthesis, $name$ is particularly essential in the production of indole-based derivatives. Its functional groups allow for efficient modifications and transformations, making it a valuable tool for chemists in designing novel molecules with desired pharmacological or biological activities.In the realm of drug discovery, 6-Nitro-1H-indole-2-carboxylic acid plays a vital role in the synthesis of potential drug candidates targeting various therapeutic areas. Its presence in the molecular structure of these compounds can impart specific functionalities or enhance their biological properties, making it an indispensable component in medicinal chemistry research.Furthermore, in the field of material science, $name$ finds applications in the development of functional materials and catalysts. Its ability to participate in diverse chemical reactions opens up opportunities for creating advanced materials with tailored properties, such as optoelectronic devices, sensors, and specialty polymers.Overall, the versatility and utility of 6-Nitro-1H-indole-2-carboxylic acid make it a valuable compound in chemical synthesis, enabling researchers and chemists to explore new avenues in drug discovery, material design, and various other scientific endeavors.