AD46259
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $72.00 | $50.00 | - + | |
50mg | 95% | in stock | $115.00 | $80.00 | - + | |
100mg | 95% | in stock | $183.00 | $128.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD46259 |
Chemical Name: | Hydroxyzine pamoate |
CAS Number: | 10246-75-0 |
Molecular Formula: | C44H43ClN2O8 |
Molecular Weight: | 763.2738 |
MDL Number: | MFCD00058051 |
SMILES: | OC(=O)c1cc2ccccc2c(c1O)Cc1c(O)c(cc2c1cccc2)C(=O)O.OCCOCCN1CCN(CC1)C(c1ccc(cc1)Cl)c1ccccc1 |
Hydroxyzine pamoate, a versatile compound in chemical synthesis, is primarily utilized as a pharmaceutical intermediate in the production of various medications. Due to its unique properties and reactivity, Hydroxyzine pamoate plays a crucial role in the synthesis of antihistamines, anxiolytics, and other pharmaceutical drugs. Its ability to serve as a building block in organic reactions enables the creation of diverse molecules with therapeutic value. In addition, Hydroxyzine pamoate's compatibility with different reaction conditions and its stability make it a valuable component in the development of novel drug compounds. Furthermore, its consistent quality and purity contribute to the reproducibility and reliability of chemical reactions, ensuring the efficiency and success of synthesis processes in the pharmaceutical industry.