AA09657
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $8.00 | $5.00 | - + | |
5mg | 98% | in stock | $16.00 | $11.00 | - + | |
10mg | 98% | in stock | $24.00 | $17.00 | - + | |
25mg | 98% | in stock | $41.00 | $29.00 | - + | |
50mg | 98% | in stock | $68.00 | $48.00 | - + | |
100mg | 98% | in stock | $114.00 | $80.00 | - + | |
250mg | 98% | in stock | $193.00 | $136.00 | - + | |
1g | 98% | in stock | $520.00 | $364.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09657 |
Chemical Name: | Sgi-1776 |
CAS Number: | 1025065-69-3 |
Molecular Formula: | C20H22F3N5O |
Molecular Weight: | 405.4168 |
MDL Number: | MFCD16659064 |
SMILES: | CN1CCC(CC1)CNc1ccc2n(n1)c(cn2)c1cccc(c1)OC(F)(F)F |
Complexity: | 529 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.3 |
Journal of medicinal chemistry 20151112
ACS medicinal chemistry letters 20131212
Bioorganic & medicinal chemistry letters 20130801
Blood 20121025
Journal of medicinal chemistry 20121011
British journal of haematology 20120101
Current drug targets 20111201
Oncotarget 20111201
British journal of cancer 20111108
Blood 20110721
Blood 20091105
Molecular cancer therapeutics 20091001