logo
Home  > 1-Iodo-1h,1h-perfluorooctane

AA09928

10258-49-8 | 1-Iodo-1h,1h-perfluorooctane

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% 1 week $176.00 $123.00 -   +
5g 97% 1 week $493.00 $345.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA09928
Chemical Name: 1-Iodo-1h,1h-perfluorooctane
CAS Number: 10258-49-8
Molecular Formula: C8H2F15I
Molecular Weight: 509.982
MDL Number: MFCD04038315
SMILES: ICC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

 

Upstream Synthesis Route 
  • 1-Iodo-1H,1H-perfluorooctane, a highly specialized compound, is a valuable reagent in chemical synthesis, particularly in the field of organic chemistry. This unique molecule serves as a key building block for the synthesis of various complex organic compounds due to its specific structural properties. Its perfluorinated backbone imparts exceptional stability and inertness, making it an ideal starting material for the preparation of diverse functionalized organic molecules. In addition, the presence of the iodine atom enables facile modifications through substitution reactions, offering chemists a versatile tool for creating intricate chemical structures. Overall, 1-iodo-1H,1H-perfluorooctane plays a crucial role in enabling the synthesis of novel compounds with tailored properties, furthering the advancement of chemical research and development.
FEATURED PRODUCTS