logo
Home  > tert-Butyl 3-(aminomethyl)benzoate

AA10159

102638-45-9 | tert-Butyl 3-(aminomethyl)benzoate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $24.00 $17.00 -   +
1g 95% in stock $80.00 $56.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA10159
Chemical Name: tert-Butyl 3-(aminomethyl)benzoate
CAS Number: 102638-45-9
Molecular Formula: C12H17NO2
Molecular Weight: 207.2689
MDL Number: MFCD08275208
SMILES: NCc1cccc(c1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The tert-Butyl 3-(aminomethyl)benzoate is a versatile compound commonly used in chemical synthesis processes. Its unique properties make it a valuable component in the production of various organic compounds. This compound serves as a crucial building block in the creation of pharmaceuticals, agrochemicals, and specialty materials. In chemical synthesis, tert-Butyl 3-(aminomethyl)benzoate plays a key role in facilitating the formation of complex molecules by acting as a reactive intermediate or a protective group. Its presence enhances the efficiency and precision of synthetic reactions, leading to the synthesis of high-quality compounds with desired characteristics. Additionally, this compound offers excellent control over regioselectivity and stereoselectivity in chemical reactions, making it an indispensable tool for chemists in designing and developing novel compounds for various applications.
FEATURED PRODUCTS