logo
Home  > 1-Naphthalenesulfonamide, 5-chloro-N-(6-phenylhexyl)-

AA10184

102649-78-5 | 1-Naphthalenesulfonamide, 5-chloro-N-(6-phenylhexyl)-

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $48.00 $34.00 -   +
5mg 95% in stock $93.00 $65.00 -   +
10mg 95% in stock $164.00 $115.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA10184
Chemical Name: 1-Naphthalenesulfonamide, 5-chloro-N-(6-phenylhexyl)-
CAS Number: 102649-78-5
Molecular Formula: C22H24ClNO2S
Molecular Weight: 401.9495
MDL Number: MFCD00065544
SMILES: Clc1cccc2c1cccc2S(=O)(=O)NCCCCCCc1ccccc1

 

Upstream Synthesis Route 
  • The compound 5-Chloro-N-(6-phenylhexyl)naphthalene-1-sulfonamide serves as a valuable reagent in chemical synthesis processes. This specialized compound is utilized as a key intermediate in the production of various organic compounds, particularly in the pharmaceutical and agrochemical industries. Its unique structure enables it to participate in important reactions, such as nucleophilic substitution and condensation reactions, facilitating the creation of novel molecular structures with specific properties. In organic synthesis, this compound plays a crucial role in the development of pharmaceuticals, advanced materials, and other specialty chemicals. Its incorporation in chemical reactions allows for the generation of diverse molecular scaffolds, making it a versatile tool for designing and producing complex organic molecules.
FEATURED PRODUCTS