AE54389
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 94% | in stock | $469.00 | $328.00 | - + | |
500mg | 94% | in stock | $1,667.00 | $1,167.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE54389 |
Chemical Name: | 1-(4-isothiocyanatobenzyl)diethylenetriaminepentaacetic acid |
CAS Number: | 102650-30-6 |
Molecular Formula: | C22H29N4O10S |
Molecular Weight: | 541.5515 |
MDL Number: | MFCD20134095 |
SMILES: | N=C=[S]c1ccc(cc1)C[C@H](N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)CC(=O)O |
The compound N-[2-[Bis(carboxymethyl)amino]ethyl]-N-[(2S)-2-[bis(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)propyl]glycine, abbreviated as $name$, is a versatile molecule widely utilized in chemical synthesis processes. This compound plays a crucial role in bioconjugation reactions, specifically in the modification of biomolecules such as proteins and peptides.$name$ is commonly used as a bifunctional chelating agent in the construction of targeted imaging agents and drug delivery systems. Its unique structure allows for the precise conjugation of targeting moieties or therapeutic cargoes to biomolecules, enabling the development of highly specific and effective bioconjugates.In organic synthesis, $name$ serves as a key component in the creation of novel materials, functionalized surfaces, and drug-like molecules. Its ability to form stable coordination complexes with various metal ions makes it valuable in catalysis and ligand design for metal-mediated reactions.Moreover, $name$ finds application in the synthesis of fluorescent probes, molecular sensors, and diagnostic agents due to its potential for labeling and tracking biological targets in vitro and in vivo. By incorporating $name$ into molecular designs, researchers can enhance the specificity and sensitivity of their chemical tools for biological studies and medical applications.