AE15365
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15365 |
Chemical Name: | 1-[[(6R,7R)-7-[[(2Z)-2-(2-AMino-4-thiazolyl)-2-[[2-(1,1-diMethylethoxy)-1,1-diMethyl-2-oxoethoxy]iMino]acetyl]aMino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]Methyl]pyridiniuM Inner Salt |
CAS Number: | 102772-66-7 |
Molecular Formula: | C26H30N6O7S2 |
Molecular Weight: | 602.6824 |
MDL Number: | MFCD21363485 |
SMILES: | O=C1[C@@H](NC(=O)/C(=N\OC(C(=O)OC(C)(C)C)(C)C)/c2csc(=N)[nH]2)[C@@H]2N1C(=C(CS2)C[n+]1ccccc1)C(=O)[O-] |
Pyridinium, 1-[[(6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-[[2-(1,1-dimethylethoxy)-1,1-dimethyl-2-oxoethoxy]imino]acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-, inner salt, is a versatile compound commonly used in chemical synthesis processes. This complex molecule plays a crucial role in the creation of various pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structural features and reactivity. The inner salt form of this pyridinium derivative enhances its stability and solubility in polar solvents, making it an ideal building block for organic reactions. As a key component in many synthetic pathways, this compound facilitates the formation of intricate molecular structures essential for the development of advanced materials and bioactive compounds. Its strategic placement within multi-step synthesis schemes underscores its significance as a valuable tool in the realm of chemical synthesis.