AB71529
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $16.00 | $11.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $32.00 | $22.00 | - + | |
10g | 95% | in stock | $43.00 | $30.00 | - + | |
25g | 95% | in stock | $90.00 | $63.00 | - + | |
100g | 95% | in stock | $358.00 | $250.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71529 |
Chemical Name: | Boc-D-Cys(Bzl)-OH |
CAS Number: | 102830-49-9 |
Molecular Formula: | C15H21NO4S |
Molecular Weight: | 311.3965 |
MDL Number: | MFCD00038253 |
SMILES: | OC(=O)[C@H](NC(=O)OC(C)(C)C)CSCc1ccccc1 |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 2.7 |
N-Boc-S-benzyl-D-cysteine is a versatile amino acid derivative widely used in chemical synthesis for the protection of the thiol functional group. This compound serves as a valuable building block in organic chemistry, enabling the selective modification of peptides and other molecules through controlled and reversible thiol protection. By incorporating N-Boc-S-benzyl-D-cysteine into synthetic routes, chemists can efficiently create intricate molecular structures with precise control over the site-specific reactions. Additionally, the compatibility of this compound with a variety of synthetic conditions makes it a valuable tool for the preparation of pharmaceuticals, agrochemicals, and advanced materials.