AE28674
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $42.00 | $29.00 | - + | |
5mg | ≥98%(HPLC) | in stock | $160.00 | $112.00 | - + | |
10mg | ≥98%(HPLC) | in stock | $232.00 | $162.00 | - + | |
25mg | ≥98%(HPLC) | in stock | $415.00 | $291.00 | - + | |
50mg | ≥98%(HPLC) | in stock | $691.00 | $484.00 | - + | |
100mg | ≥98%(HPLC) | in stock | $1,055.00 | $739.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE28674 |
Chemical Name: | VUF 10460 |
CAS Number: | 1028327-66-3 |
Molecular Formula: | C15H19N5 |
Molecular Weight: | 269.3449 |
MDL Number: | MFCD00055218 |
SMILES: | CN1CCN(CC1)c1nc(N)nc(c1)c1ccccc1 |
Complexity: | 297 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.8 |
Bioorganic & medicinal chemistry letters 20110915
Journal of medicinal chemistry 20081023
Journal of medicinal chemistry 20081023