AB50606
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $42.00 | $29.00 | - + | |
5mg | 95% | in stock | $169.00 | $118.00 | - + | |
50mg | 95% | in stock | $211.00 | $148.00 | - + | |
100mg | 95% | in stock | $345.00 | $242.00 | - + | |
250mg | 95% | in stock | $564.00 | $395.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50606 |
Chemical Name: | Alisertib |
CAS Number: | 1028486-01-2 |
Molecular Formula: | C27H20ClFN4O4 |
Molecular Weight: | 518.9235 |
MDL Number: | MFCD16621243 |
SMILES: | COc1cccc(c1C1=NCc2c(-c3c1cc(Cl)cc3)nc(nc2)Nc1ccc(c(c1)OC)C(=O)O)F |
The compound 4-((9-Chloro-7-(2-fluoro-6-methoxyphenyl)-5H-benzo[c]pyrimido[4,5-e]azepin-2-yl)amino)-2-methoxybenzoic acid is a versatile reagent commonly utilized in chemical synthesis. It serves as a key building block for the creation of novel pharmaceutical agents and organic compounds due to its unique structural characteristics. Its presence in synthetic pathways enables chemists to access a diverse array of functional groups and molecular frameworks, making it a valuable tool in drug discovery and material science research. By incorporating this compound into synthetic routes, researchers can access a wide range of molecular structures with potential applications in various fields of chemistry.