AI05747
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI05747 |
Chemical Name: | 4-Chloro-1-tosyl-1h-indole |
CAS Number: | 102855-24-3 |
Molecular Formula: | C15H12ClNO2S |
Molecular Weight: | 305.7793 |
MDL Number: | MFCD28130224 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)n1ccc2c1cccc2Cl |
Complexity: | 439 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.2 |
4-Chloro-1-tosyl-1H-indole is a versatile compound widely used in chemical synthesis due to its unique properties. In organic chemistry, it serves as a valuable building block for the preparation of various functionalized molecules. This compound is particularly valuable in the synthesis of pharmaceutical intermediates and agrochemicals. Its reactivity allows for the introduction of diverse functional groups, making it a valuable tool in the construction of complex organic structures. Additionally, 4-Chloro-1-tosyl-1H-indole is utilized in the production of novel materials, serving as a key component in the development of advanced chemical technologies. Its broad applicability and consistent performance make it an essential reagent in the toolkit of synthetic chemists.