AI05762
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $90.00 | $63.00 | - + | |
1g | 98% | in stock | $201.00 | $141.00 | - + | |
5g | 98% | in stock | $572.00 | $400.00 | - + | |
10g | 98% | in stock | $945.00 | $661.00 | - + | |
25g | 98% | in stock | $1,878.00 | $1,315.00 | - + | |
100g | 98% | in stock | $5,608.00 | $3,925.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI05762 |
Chemical Name: | 4-(3-Methylphenoxy)phenylboronic acid |
CAS Number: | 1029438-39-8 |
Molecular Formula: | C13H13BO3 |
Molecular Weight: | 228.0515 |
MDL Number: | MFCD28024838 |
SMILES: | Cc1cccc(c1)Oc1ccc(cc1)B(O)O |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
4-(3-Methylphenoxy)phenylboronic acid is a versatile compound commonly used in chemical synthesis. Due to its unique structure, this boronic acid derivative serves as a valuable building block in the assembly of various organic materials. One notable application of 4-(3-Methylphenoxy)phenylboronic acid is in Suzuki-Miyaura cross-coupling reactions, a widely utilized method for forming carbon-carbon bonds. By incorporating this compound into the reaction mixture, chemists can efficiently construct complex organic molecules with tailored functionalities. Additionally, the presence of the boronic acid moiety enables further derivatization through classic transformations such as the Suzuki reaction, making it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and materials science.