AI05789
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 99% | in stock | $11.00 | $8.00 | - + | |
50mg | 99% | in stock | $16.00 | $11.00 | - + | |
100mg | 99% | in stock | $19.00 | $14.00 | - + | |
250mg | 99% | in stock | $23.00 | $17.00 | - + | |
1g | 99% | in stock | $56.00 | $39.00 | - + | |
5g | 99% | in stock | $117.00 | $82.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI05789 |
Chemical Name: | Trelagliptin succinate |
CAS Number: | 1029877-94-8 |
Molecular Formula: | C22H26FN5O6 |
Molecular Weight: | 475.4701 |
MDL Number: | MFCD22665720 |
SMILES: | OC(=O)CCC(=O)O.N#Cc1ccc(cc1Cn1c(cc(=O)n(c1=O)C)N1CCC[C@H](C1)N)F |
Complexity: | 750 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
Journal of cellular physiology 19760101