103112-35-2 | Fenchlorazol-ethyl

Availability
Typically In Stock

Description

• Catalog Number: AE08423
• Chemical Name: Fenchlorazol-ethyl
• CAS Number: 103112-35-2
• Molecular Formula: C12H8Cl5N3O2
• Molecular Weight: 403.47582
• MDL Number: MFCD02101622
• SMILES: CCOC(=O)c1nn(c(n1)C(Cl)(Cl)Cl)c1ccc(cc1Cl)Cl

Upstream Synthesis Route

Fenchlorazole-ethyl is a versatile compound commonly employed in chemical synthesis for its unique properties and applications. As a fungicide, it plays a crucial role in protecting crops from various fungal diseases, making it an essential tool for maintaining agricultural productivity. In chemical synthesis, Fenchlorazole-ethyl serves as a key building block for the creation of novel compounds and pharmaceuticals. Its ability to inhibit fungal growth by disrupting key metabolic pathways makes it an invaluable asset in the development of new antimicrobial agents. Additionally, Fenchlorazole-ethyl's structure and reactivity make it a valuable reagent for the modification of organic molecules, enabling chemists to access diverse chemical space and explore new avenues in synthetic chemistry.