AD70528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | 1 week | $286.00 | $200.00 | - + | |
5mg | 99% | 1 week | $709.00 | $496.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70528 |
Chemical Name: | Glutaryl coenzyme A lithium salt |
CAS Number: | 103192-48-9 |
Molecular Formula: | C14H24LiN5O11P3 |
Molecular Weight: | 538.2295 |
MDL Number: | MFCD00057772 |
SMILES: | O=POC1C(COP(=O)(OP(=O)(OCC(C)C)O)O)OC(C1O)n1cnc2c1ncnc2N.[Li] |
Coenzyme A, S-(hydrogen pentanedioate), dilithium salt is a versatile compound widely used in chemical synthesis. With its unique structure and properties, this compound plays a crucial role in various reactions and transformations in organic chemistry. One primary application of this compound is in the acyl group transfer reactions. It serves as a crucial cofactor in numerous enzymatic reactions that involve the transfer of acyl groups between different molecules. This ability makes it an essential component in the synthesis of various organic compounds, including fatty acids, cholesterol, and peptides.Furthermore, Coenzyme A dilithium salt is also utilized as a catalyst in esterification reactions. Its ability to facilitate the formation of ester bonds is particularly valuable in the production of fragrances, pharmaceuticals, and other high-value compounds. Additionally, it is employed in the synthesis of thioesters, which are important intermediates in numerous biochemical pathways.Overall, Coenzyme A, S-(hydrogen pentanedioate), dilithium salt is a powerful tool in chemical synthesis, enabling the efficient and selective formation of various organic compounds through acyl group transfer reactions and esterification processes. Its versatile applications make it a valuable asset in the arsenal of synthetic chemists.