AE08376
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08376 |
Chemical Name: | DESETHYLENE CIPROFLOXACIN |
CAS Number: | 103222-12-4 |
Molecular Formula: | C15H16FN3O3 |
Molecular Weight: | 305.3042 |
MDL Number: | MFCD04973586 |
SMILES: | NCCNc1cc2c(cc1F)c(=O)c(cn2C1CC1)C(=O)O |
3-Quinolinecarboxylicacid, 7-[(2-aminoethyl)amino]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo- is a versatile compound widely utilized in chemical synthesis. One important application of this compound is its role as a building block in the synthesis of novel pharmaceutical agents. By incorporating this unique structure into organic molecules, chemists can fine-tune the properties and functionalities of the resulting compounds, potentially leading to the development of new drugs with improved therapeutic effects. Additionally, the presence of functional groups such as the amino and fluoro moieties in this compound offers opportunities for further derivatization, allowing for the creation of diverse chemical libraries for drug discovery efforts. In summary, the strategic use of 3-Quinolinecarboxylicacid, 7-[(2-aminoethyl)amino]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo- in chemical synthesis enables the synthesis of complex molecules with potential pharmaceutical applications.