AE09191
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 90% | 2 weeks | $486.00 | $341.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09191 |
Chemical Name: | BIOTIN-4-FLUORESCEIN |
CAS Number: | 1032732-74-3 |
Molecular Formula: | C33H32N4O8S |
Molecular Weight: | 644.6942 |
MDL Number: | MFCD09264223 |
SMILES: | O=C(NCCNC(=O)c1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2c1ccc(c2)O)O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2 |
The compound (3aS,4S,6aR)-N-[2-[[(3′,6′-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-5-yl)carbonyl]amino]ethyl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanamide plays a crucial role in chemical synthesis as a versatile building block. Due to its unique structure and functional groups, it serves as a key intermediate in the creation of complex organic molecules. This compound can be utilized in various synthetic pathways to introduce specific functionalities, modify existing chemical structures, or facilitate specific reactions. Its presence enhances the efficiency and precision of chemical transformations, making it a valuable tool in the hands of synthetic chemists.