AY26000
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY26000 |
Chemical Name: | Glycine, N,N'-1,2-ethanediylbis[N-(2-hydroxyphenyl)- |
CAS Number: | 10328-28-6 |
Molecular Formula: | C18H20N2O6 |
Molecular Weight: | 360.3612 |
SMILES: | OC(=O)CN(c1ccccc1O)CCN(c1ccccc1O)CC(=O)O |
In chemical synthesis, Glycine, N,N'-1,2-ethanediylbis[N-(2-hydroxyphenyl)- serves as a versatile building block for the preparation of various compounds. It acts as a key reagent in the formation of complex molecules with multiple functional groups. With its unique structure containing two hydroxyphenyl groups linked by an ethanediyl chain, it enables the synthesis of polymers, dendrimers, and other macromolecules with specific properties and applications. Its ability to participate in cross-coupling reactions, condensation reactions, and other transformations makes it an essential component in the creation of advanced materials and pharmaceuticals. By incorporating Glycine, N,N'-1,2-ethanediylbis[N-(2-hydroxyphenyl)- into chemical reactions, researchers and chemists can access a wide range of compounds with tailored structures and functionalities for various industrial and scientific purposes.