AB60942
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $28.00 | $20.00 | - + | |
5g | 98% | in stock | $119.00 | $84.00 | - + | |
25g | 98% | in stock | $174.00 | $122.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60942 |
Chemical Name: | Guanine sulfate |
CAS Number: | 10333-92-3 |
Molecular Formula: | C5H7N5O5S |
Molecular Weight: | 249.2046 |
MDL Number: | MFCD00213671 |
SMILES: | OS(=O)(=O)O.Nc1nc2nc[nH]c2c(=O)[nH]1 |
2-Amino-1H-purin-6(7H)-one sulfate, also known by its chemical formula C5H5N5O4S, is a versatile compound widely utilized in chemical synthesis processes. This compound plays a crucial role in the development of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique properties and reactivity.In chemical synthesis, 2-Amino-1H-purin-6(7H)-one sulfate serves as a key building block for the creation of various important compounds. Its amino and purine moieties make it a valuable starting material for the synthesis of nucleoside analogs, heterocyclic compounds, and other bioactive molecules. By carefully manipulating the functional groups present in this compound, chemists can create a diverse range of derivatives with tailored properties and functions.Furthermore, the sulfate group attached to 2-Amino-1H-purin-6(7H)-one enhances its solubility and stability, making it easier to handle in synthetic reactions. This feature is particularly beneficial in aqueous environments or when working with polar solvents, ensuring efficient and reliable chemical transformations.Overall, the versatile nature of 2-Amino-1H-purin-6(7H)-one sulfate makes it an indispensable tool in the field of chemical synthesis, enabling researchers to access novel compounds and advance scientific understanding across various disciplines.