AB53334
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $57.00 | $40.00 | - + | |
1g | 98% | in stock | $150.00 | $105.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53334 |
Chemical Name: | CARBAMIC ACID, N-[(3S,4R)-4-FLUORO-3-PYRROLIDINYL]-, 1,1-DIMETHYLETHYL ESTER |
CAS Number: | 1033718-89-6 |
Molecular Formula: | C9H17FN2O2 |
Molecular Weight: | 204.2419 |
MDL Number: | MFCD24368651 |
SMILES: | F[C@@H]1CNC[C@@H]1NC(=O)OC(C)(C)C |
The tert-Butyl ((3S,4R)-4-fluoropyrrolidin-3-yl)carbamate is a valuable compound widely used in chemical synthesis processes. It serves as a versatile building block with a strategic structural motif that enables the creation of various complex molecules in synthetic organic chemistry. This compound is particularly instrumental in the synthesis of pharmaceuticals and agrochemicals due to its ability to introduce specific functionalities and stereochemistry into target molecules. Its unique structural features make it a key intermediate in the development of novel drug candidates and biologically active compounds. In addition, the tert-Butyl ((3S,4R)-4-fluoropyrrolidin-3-yl)carbamate plays a crucial role in the design and preparation of chiral ligands and catalysts for asymmetric synthesis, contributing to the advancement of stereocontrolled reactions in chemical research. Through its applications in chemical synthesis, this compound demonstrates its significance as a fundamental building block for the construction of diverse molecular structures with important implications across various scientific disciplines.