AI90000
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI90000 |
Chemical Name: | rac-(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
CAS Number: | 1034079-37-2 |
Molecular Formula: | C7H10O3 |
Molecular Weight: | 142.1525 |
MDL Number: | MFCD28390508 |
SMILES: | OC(=O)[C@H]1C[C@@H]2O[C@H]1CC2 |
Rac-(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid is a versatile compound commonly employed in chemical synthesis. Its unique molecular structure makes it a valuable building block in organic chemistry processes. This compound can serve as a key intermediate in the preparation of various pharmaceuticals, natural products, and functional materials. Through strategic manipulation of its functional groups, researchers can access a wide range of stereochemically complex molecules. Additionally, Rac-(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid can participate in diverse reactions, enabling the efficient creation of intricate molecular architectures. Its utility in asymmetric synthesis and its ability to impart chirality make it particularly valuable in the fine chemical industry.