logo
Home  > Clarithromycin 9-Oxime

AE15696

103450-87-9 | Clarithromycin 9-Oxime

Packsize Purity Availability Price Discounted Price    Quantity
10mg 95% in stock $314.00 $220.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE15696
Chemical Name: Clarithromycin 9-Oxime
CAS Number: 103450-87-9
Molecular Formula: C38H70N2O13
Molecular Weight: 762.968
MDL Number: MFCD29060002
SMILES: O/N=C1/[C@@H](C)C[C@](C)(OC)[C@@H](O[C@H]2O[C@@H](C)C[C@H]([C@@H]2O)N(C)C)[C@H](C)[C@@H](O[C@H]2O[C@H](C)[C@H]([C@@](C2)(C)OC)O)[C@@H](C(=O)O[C@H]([C@]([C@H]([C@@H]1C)O)(C)O)CC)C

 

Upstream Synthesis Route 
  • Clarithromycin 9-Oxime (E/Z mixture) is a versatile compound frequently employed in chemical synthesis for its ability to act as a key building block in the creation of various pharmaceuticals and other valuable organic molecules. This specific mixture offers a range of possibilities due to the presence of both E and Z isomers, allowing for the synthesis of a diverse array of compounds with different stereochemical characteristics. In synthesis, Clarithromycin 9-Oxime (E/Z mixture) can serve as a crucial intermediate, enabling the formation of complex structures and facilitating the development of new drug candidates or fine chemicals. Through strategic manipulation of the E/Z isomers, chemists can fine-tune the properties and reactivity of the resulting products, making this compound an indispensable tool in modern organic chemistry research and development.
FEATURED PRODUCTS