logo
Home  > GSK2018682

AX64512

1034688-30-6 | GSK2018682

Packsize Purity Availability Price Discounted Price    Quantity
5mg 95% in stock $73.00 $51.00 -   +
10mg 95% in stock $111.00 $78.00 -   +
25mg 95% in stock $245.00 $172.00 -   +
100mg 95% in stock $789.00 $552.00 -   +
250mg 95% in stock $1,539.00 $1,077.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX64512
Chemical Name: GSK2018682
CAS Number: 1034688-30-6
Molecular Formula: C22H21ClN4O4
Molecular Weight: 440.8795
MDL Number: MFCD18633078
SMILES: OC(=O)CCCn1ccc2c1cccc2c1noc(n1)c1cnc(c(c1)Cl)OC(C)C

 

Upstream Synthesis Route
  • GSK 2018682 is a versatile chemical compound commonly utilized in organic synthesis as a key building block for creating complex molecular structures. Its unique molecular properties make it an essential component in various chemical reactions, allowing for the efficient and selective formation of specific bonds. In the realm of chemical synthesis, GSK 2018682 serves as a crucial reagent for the creation of diverse pharmaceutical intermediates, agrochemicals, and functional materials. Its wide-ranging application in the synthesis of organic compounds highlights its significant role in advancing scientific research and innovation across various industries.
FEATURED PRODUCTS