AB74319
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $19.00 | $13.00 | - + | |
5g | 97% | in stock | $29.00 | $20.00 | - + | |
25g | 97% | in stock | $129.00 | $90.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB74319 |
Chemical Name: | Fmoc-n-methyl-d-valine |
CAS Number: | 103478-58-6 |
Molecular Formula: | C21H23NO4 |
Molecular Weight: | 353.4116 |
MDL Number: | MFCD00153396 |
SMILES: | CC([C@@H](N(C(=O)OCC1c2ccccc2-c2c1cccc2)C)C(=O)O)C |
Complexity: | 498 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.2 |
Fmoc-D-N-Me-Val-OH is a versatile amino acid derivative commonly used in chemical synthesis for the selective protection of amino groups during peptide and organic molecule synthesis. This compound is particularly valuable in solid-phase peptide synthesis due to its ability to protect the N-terminal amino group of amino acids.In peptide synthesis, Fmoc-D-N-Me-Val-OH serves as a key building block for the production of peptides with specific sequences. By temporarily masking the amino group with the Fmoc protecting group, the peptide chain can be elongated step by step, with precise control over the sequence and structure of the final peptide product. Upon completion of the synthesis, the Fmoc protecting group can be easily removed under mild conditions to reveal the free amino group, allowing for further modification or conjugation.Furthermore, Fmoc-D-N-Me-Val-OH finds applications beyond peptide synthesis, such as in the preparation of diverse organic molecules and pharmaceutical intermediates. Its compatibility with various coupling reagents and solid supports makes it a valuable tool for chemists working in the field of organic synthesis.Overall, Fmoc-D-N-Me-Val-OH plays a crucial role in facilitating the efficient and precise assembly of complex molecules in chemical synthesis, making it an indispensable component in the toolkit of synthetic chemists.