logo
Home  > Life Science  > DNA/RNA  > Nucleosides & Nucleotides  > 4-Amino-5-fluoro-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one

AD80335

10356-76-0 | 4-Amino-5-fluoro-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $12.00 $9.00 -   +
100mg 95% in stock $21.00 $15.00 -   +
250mg 95% in stock $27.00 $19.00 -   +
1g 95% in stock $58.00 $41.00 -   +
5g 95% in stock $269.00 $188.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD80335
Chemical Name: 4-Amino-5-fluoro-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one
CAS Number: 10356-76-0
Molecular Formula: C9H12FN3O4
Molecular Weight: 245.2077
MDL Number: MFCD00077348
SMILES: OC[C@H]1O[C@H](C[C@@H]1O)n1cc(F)c(nc1=O)N

 

Computed Properties
Complexity: 398  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 3  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 2  
XLogP3: -1.5  

 

 

Upstream Synthesis Route 
  • 5-Fluoro-2'-deoxycytidine, commonly known as 5FdC, is a key chemical compound widely used in chemical synthesis processes. As a derivative of deoxycytidine, 5FdC plays a crucial role in organic chemistry due to its unique properties and versatile applications.One of the primary applications of 5-Fluoro-2'-deoxycytidine in chemical synthesis is its utilization as a building block for nucleoside analogs. By incorporating 5FdC into the structure of nucleosides, researchers can modify the properties of the resulting compounds, leading to the development of novel molecules with potential pharmacological activities. Additionally, 5FdC can serve as a precursor for the synthesis of modified DNA and RNA molecules, offering opportunities for genetic engineering and drug discovery efforts.Furthermore, 5-Fluoro-2'-deoxycytidine is often employed in the production of fluorescent probes for biological imaging studies. Its fluorine substituent enhances the visibility and detection of target molecules within cellular environments, making it a valuable tool in biochemical research and diagnostics. Moreover, the chemical reactivity of 5FdC enables its use as a chemical tag for labeling biomolecules, facilitating the tracking and analysis of biological processes at the molecular level.Overall, the application of 5-Fluoro-2'-deoxycytidine in chemical synthesis encompasses a wide range of fields, including medicinal chemistry, bioconjugation, and molecular biology. Its versatility and unique chemical properties make it a valuable component in the design and development of innovative compounds with diverse applications in research and industry.
Literature
FEATURED PRODUCTS