AY26247
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $249.00 | $175.00 | - + | |
250mg | 95% | in stock | $448.00 | $314.00 | - + | |
1g | 95% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY26247 |
Chemical Name: | 2(1H)-Pyrimidinone, 5-bromo-1-(phenylmethyl)- |
CAS Number: | 103594-68-9 |
Molecular Formula: | C11H9BrN2O |
Molecular Weight: | 265.106 |
MDL Number: | MFCD29038573 |
SMILES: | Brc1cnc(=O)n(c1)Cc1ccccc1 |
In chemical synthesis, 2(1H)-Pyrimidinone, 5-bromo-1-(phenylmethyl)- serves as a versatile building block for creating novel compounds with potential biological activities. This compound can be utilized as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it a valuable component in the development of diverse molecules through organic transformations and functional group manipulations. Additionally, the presence of the bromine substituent provides opportunities for further derivatization, enabling the synthesis of structurally diverse analogs for structure-activity relationship studies and drug discovery efforts.