AE13045
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $26.00 | $19.00 | - + | |
10g | 98% | in stock | $49.00 | $35.00 | - + | |
15g | 98% | in stock | $63.00 | $45.00 | - + | |
25g | 98% | in stock | $91.00 | $64.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE13045 |
Chemical Name: | N-Me-Ala-OtBu HCl |
CAS Number: | 103614-40-0 |
Molecular Formula: | C8H18ClNO2 |
Molecular Weight: | 195.687 |
MDL Number: | MFCD08457605 |
SMILES: | CN[C@H](C(=O)OC(C)(C)C)C.Cl |
Complexity: | 138 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
(S)-tert-Butyl 2-(methylamino)propanoate hydrochloride, a key chemical compound in chemical synthesis, serves as a versatile building block in the creation of advanced pharmaceuticals and fine chemicals. Its unique molecular structure allows for precise manipulation and control over stereochemistry, enabling the synthesis of complex molecules with high levels of chemo- and regioselectivity. This compound plays a crucial role in the development of novel drugs, agrochemicals, and materials by facilitating the introduction of specific functional groups and enabling the synthesis of enantiopure compounds. Its application extends to asymmetric synthesis, medicinal chemistry, and materials science, making it an indispensable tool for researchers and chemists in the field of organic synthesis.