logo
Home  > Benzoic acid, 2-(beta-D-glucopyranosyloxy)-

AE22312

10366-91-3 | Benzoic acid, 2-(beta-D-glucopyranosyloxy)-

Packsize Purity Availability Price Discounted Price    Quantity
500mg 3 weeks $2,277.00 $1,594.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE22312
Chemical Name: Benzoic acid, 2-(beta-D-glucopyranosyloxy)-
CAS Number: 10366-91-3
Molecular Formula: C13H16O8
Molecular Weight: 300.2613
MDL Number: MFCD06203147
SMILES: OC[C@H]1OC(Oc2ccccc2C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O

 

Upstream Synthesis Route
  • Salicylic acid 2-O-β-D-glucoside is a versatile compound widely utilized in chemical synthesis for its valuable properties and applications. This molecule serves as a crucial intermediate in organic chemistry reactions, particularly in the synthesis of various pharmaceuticals, agrochemicals, and natural products. Its structure, consisting of a salicylic acid moiety linked to a glucose unit, enables it to participate in diverse chemical transformations.In chemical synthesis, Salicylic acid 2-O-β-D-glucoside acts as a precursor for the production of salicylates, which are commonly used in the pharmaceutical industry for their anti-inflammatory and analgesic properties. By selectively modifying the salicylic acid or glucose portions of the molecule, chemists can tailor the compound for specific therapeutic applications. Additionally, this compound can serve as a starting material for the synthesis of glycosides, which are important constituents in natural products and bioactive compounds.Furthermore, Salicylic acid 2-O-β-D-glucoside plays a significant role in the development of novel drug compounds and bioconjugates due to its functional groups that facilitate conjugation with other molecules. Its presence in chemical reactions often enhances the selectivity, efficiency, and overall success of the synthetic process. Overall, the application of Salicylic acid 2-O-β-D-glucoside in chemical synthesis showcases its versatility and importance in the field of organic chemistry.
FEATURED PRODUCTS